C25H30ClNO3 — CID 17055084
2-(3,4-dimethoxyphenyl)-N-[[3-[(4-methylphenyl)methoxy]phenyl]methyl]ethanamine;hydrochloride (PubChem CID 17055084) has the molecular formula C25H30ClNO3 and a molecular weight of 427.97 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[[3-[(4-methylphenyl)methoxy]phenyl]methyl]ethanamine;hydrochloride.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[[3-[(4-methylphenyl)methoxy]phenyl]methyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17055084 |
| Molecular Formula | C25H30ClNO3 |
| Molecular Weight | 427.97 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[[3-[(4-methylphenyl)methoxy]phenyl]methyl]ethanamine;hydrochloride |
| SMILES | COc1ccc(CCNCc2cccc(OCc3ccc(C)cc3)c2)cc1OC.Cl |
| InChI | InChI=1S/C25H29NO3.ClH/c1-19-7-9-21(10-8-19)18-29-23-6-4-5-22(15-23)17-26-14-13-20-11-12-24(27-2)25(16-20)28-3;/h4-12,15-16,26H,13-14,17-18H2,1-3H3;1H |
| InChIKey | XNNFACCDIKKRDE-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.97 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|