C15H12N6O2 — CID 170550869
2-imidazo[1,2-b]pyridazin-3-yl-6-methoxyindazole-5-carboxamide (PubChem CID 170550869) has the molecular formula C15H12N6O2 and a molecular weight of 308.30 g/mol. Its IUPAC name is 2-imidazo[1,2-b]pyridazin-3-yl-6-methoxyindazole-5-carboxamide.
| Compound Name | 2-imidazo[1,2-b]pyridazin-3-yl-6-methoxyindazole-5-carboxamide |
|---|---|
| PubChem CID | 170550869 |
| Molecular Formula | C15H12N6O2 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 2-imidazo[1,2-b]pyridazin-3-yl-6-methoxyindazole-5-carboxamide |
| SMILES | COc1cc2nn(-c3cnc4cccnn34)cc2cc1C(N)=O |
| InChI | InChI=1S/C15H12N6O2/c1-23-12-6-11-9(5-10(12)15(16)22)8-20(19-11)14-7-17-13-3-2-4-18-21(13)14/h2-8H,1H3,(H2,16,22) |
| InChIKey | VZUFYCTUBWJHMS-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 100.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |