C39H45N9O4 — CID 176797258
N-[4-[2-[4-[4-(2,6-dioxopiperidin-3-yl)-3-methylphenyl]piperazin-1-yl]ethyl]cyclohexyl]-2-imidazo[1,2-b]pyridazin-3-yl-6-methoxyindazole-5-carboxamide (PubChem CID 176797258) has the molecular formula C39H45N9O4 and a molecular weight of 703.85 g/mol. Its IUPAC name is N-[4-[2-[4-[4-(2,6-dioxopiperidin-3-yl)-3-methylphenyl]piperazin-1-yl]ethyl]cyclohexyl]-2-imidazo[1,2-b]pyridazin-3-yl-6-methoxyindazole-5-carboxamide.
| Compound Name | N-[4-[2-[4-[4-(2,6-dioxopiperidin-3-yl)-3-methylphenyl]piperazin-1-yl]ethyl]cyclohexyl]-2-imidazo[1,2-b]pyridazin-3-yl-6-methoxyindazole-5-carboxamide |
|---|---|
| PubChem CID | 176797258 |
| Molecular Formula | C39H45N9O4 |
| Molecular Weight | 703.85 g/mol |
| Exact Mass | 703.36 |
| IUPAC Name | N-[4-[2-[4-[4-(2,6-dioxopiperidin-3-yl)-3-methylphenyl]piperazin-1-yl]ethyl]cyclohexyl]-2-imidazo[1,2-b]pyridazin-3-yl-6-methoxyindazole-5-carboxamide |
| SMILES | COc1cc2nn(-c3cnc4cccnn34)cc2cc1C(=O)NC1CCC(CCN2CCN(c3ccc(C4CCC(=O)NC4=O)c(C)c3)CC2)CC1 |
| InChI | InChI=1S/C39H45N9O4/c1-25-20-29(9-10-30(25)31-11-12-36(49)43-38(31)50)46-18-16-45(17-19-46)15-13-26-5-7-28(8-6-26)42-39(51)32-21-27-24-47(44-33(27)22-34(32)52-2)37-23-40-35-4-3-14-41-48(35)37/h3-4,9-10,14,20-24,26,28,31H,5-8,11-13,15-19H2,1-2H3,(H,42,51)(H,43,49,50) |
| InChIKey | WOXTYSAUJIPLQL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 138.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.85 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|