C27H27F7N8O2 — CID 170550912
benzyl N-[(S)-(4,4-difluorocyclohexyl)-[7-[3,3-difluoro-1-[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]propyl]imidazo[1,2-b]pyridazin-2-yl]methyl]carbamate (PubChem CID 170550912) has the molecular formula C27H27F7N8O2 and a molecular weight of 628.55 g/mol. Its IUPAC name is benzyl N-[(S)-(4,4-difluorocyclohexyl)-[7-[3,3-difluoro-1-[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]propyl]imidazo[1,2-b]pyridazin-2-yl]methyl]carbamate.
| Compound Name | benzyl N-[(S)-(4,4-difluorocyclohexyl)-[7-[3,3-difluoro-1-[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]propyl]imidazo[1,2-b]pyridazin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 170550912 |
| Molecular Formula | C27H27F7N8O2 |
| Molecular Weight | 628.55 g/mol |
| Exact Mass | 628.21 |
| IUPAC Name | benzyl N-[(S)-(4,4-difluorocyclohexyl)-[7-[3,3-difluoro-1-[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]propyl]imidazo[1,2-b]pyridazin-2-yl]methyl]carbamate |
| SMILES | O=C(N[C@H](c1cn2ncc(C(CC(F)F)c3nnnn3CC(F)(F)F)cc2n1)C1CCC(F)(F)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C27H27F7N8O2/c28-21(29)11-19(24-38-39-40-42(24)15-27(32,33)34)18-10-22-36-20(13-41(22)35-12-18)23(17-6-8-26(30,31)9-7-17)37-25(43)44-14-16-4-2-1-3-5-16/h1-5,10,12-13,17,19,21,23H,6-9,11,14-15H2,(H,37,43)/t19?,23-/m0/s1 |
| InChIKey | VPXQCSHPBVBSIG-BVHINDKJSA-N |
| XLogP | 5.86 |
| TPSA | 112.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.55 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |