C13H17N3O3 — CID 170552680
(4aS)-3-methyl-9-nitro-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][4,1]benzoxazepine (PubChem CID 170552680) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is (4aS)-3-methyl-9-nitro-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][4,1]benzoxazepine.
| Compound Name | (4aS)-3-methyl-9-nitro-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][4,1]benzoxazepine |
|---|---|
| PubChem CID | 170552680 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | (4aS)-3-methyl-9-nitro-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][4,1]benzoxazepine |
| SMILES | CN1CCN2c3ccc([N+](=O)[O-])cc3COC[C@@H]2C1 |
| InChI | InChI=1S/C13H17N3O3/c1-14-4-5-15-12(7-14)9-19-8-10-6-11(16(17)18)2-3-13(10)15/h2-3,6,12H,4-5,7-9H2,1H3/t12-/m0/s1 |
| InChIKey | RZVNRGDVQDBDKQ-LBPRGKRZSA-N |
| XLogP | 1.25 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|