C16H23N3O5S — CID 170555032
tert-butyl N-[3-[[(2-methylphenyl)sulfonylhydrazinylidene]methyl]oxetan-3-yl]carbamate (PubChem CID 170555032) has the molecular formula C16H23N3O5S and a molecular weight of 369.44 g/mol. Its IUPAC name is tert-butyl N-[3-[[(2-methylphenyl)sulfonylhydrazinylidene]methyl]oxetan-3-yl]carbamate.
| Compound Name | tert-butyl N-[3-[[(2-methylphenyl)sulfonylhydrazinylidene]methyl]oxetan-3-yl]carbamate |
|---|---|
| PubChem CID | 170555032 |
| Molecular Formula | C16H23N3O5S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | tert-butyl N-[3-[[(2-methylphenyl)sulfonylhydrazinylidene]methyl]oxetan-3-yl]carbamate |
| SMILES | Cc1ccccc1S(=O)(=O)NN=CC1(NC(=O)OC(C)(C)C)COC1 |
| InChI | InChI=1S/C16H23N3O5S/c1-12-7-5-6-8-13(12)25(21,22)19-17-9-16(10-23-11-16)18-14(20)24-15(2,3)4/h5-9,19H,10-11H2,1-4H3,(H,18,20) |
| InChIKey | UXGFPZQTRSRGQN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|