C16H12ClN3O3S — CID 170555669
6-(4-chloro-1,3-dioxoisoindol-2-yl)-N-(2-sulfanylethyl)pyridine-3-carboxamide (PubChem CID 170555669) has the molecular formula C16H12ClN3O3S and a molecular weight of 361.81 g/mol. Its IUPAC name is 6-(4-chloro-1,3-dioxoisoindol-2-yl)-N-(2-sulfanylethyl)pyridine-3-carboxamide.
| Compound Name | 6-(4-chloro-1,3-dioxoisoindol-2-yl)-N-(2-sulfanylethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 170555669 |
| Molecular Formula | C16H12ClN3O3S |
| Molecular Weight | 361.81 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | 6-(4-chloro-1,3-dioxoisoindol-2-yl)-N-(2-sulfanylethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCCS)c1ccc(N2C(=O)c3cccc(Cl)c3C2=O)nc1 |
| InChI | InChI=1S/C16H12ClN3O3S/c17-11-3-1-2-10-13(11)16(23)20(15(10)22)12-5-4-9(8-19-12)14(21)18-6-7-24/h1-5,8,24H,6-7H2,(H,18,21) |
| InChIKey | VTUZGNYOJAAIFL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.81 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|