C14H19N2O7P — CID 170556195
benzyl 5-bis(methylperoxy)phosphoryl-5-methyl-1,4-dihydropyrazole-3-carboxylate (PubChem CID 170556195) has the molecular formula C14H19N2O7P and a molecular weight of 358.29 g/mol. Its IUPAC name is benzyl 5-bis(methylperoxy)phosphoryl-5-methyl-1,4-dihydropyrazole-3-carboxylate.
| Compound Name | benzyl 5-bis(methylperoxy)phosphoryl-5-methyl-1,4-dihydropyrazole-3-carboxylate |
|---|---|
| PubChem CID | 170556195 |
| Molecular Formula | C14H19N2O7P |
| Molecular Weight | 358.29 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | benzyl 5-bis(methylperoxy)phosphoryl-5-methyl-1,4-dihydropyrazole-3-carboxylate |
| SMILES | COOP(=O)(OOC)C1(C)CC(C(=O)OCc2ccccc2)=NN1 |
| InChI | InChI=1S/C14H19N2O7P/c1-14(24(18,22-19-2)23-20-3)9-12(15-16-14)13(17)21-10-11-7-5-4-6-8-11/h4-8,16H,9-10H2,1-3H3 |
| InChIKey | RMYHMELWHYCCQN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 104.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|