C16H12F3N3O3 — CID 170556634
methyl 3-(4-cyano-2-methylphenoxy)-5-methyl-6-(trifluoromethyl)pyridazine-4-carboxylate (PubChem CID 170556634) has the molecular formula C16H12F3N3O3 and a molecular weight of 351.28 g/mol. Its IUPAC name is methyl 3-(4-cyano-2-methylphenoxy)-5-methyl-6-(trifluoromethyl)pyridazine-4-carboxylate.
| Compound Name | methyl 3-(4-cyano-2-methylphenoxy)-5-methyl-6-(trifluoromethyl)pyridazine-4-carboxylate |
|---|---|
| PubChem CID | 170556634 |
| Molecular Formula | C16H12F3N3O3 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | methyl 3-(4-cyano-2-methylphenoxy)-5-methyl-6-(trifluoromethyl)pyridazine-4-carboxylate |
| SMILES | COC(=O)c1c(Oc2ccc(C#N)cc2C)nnc(C(F)(F)F)c1C |
| InChI | InChI=1S/C16H12F3N3O3/c1-8-6-10(7-20)4-5-11(8)25-14-12(15(23)24-3)9(2)13(21-22-14)16(17,18)19/h4-6H,1-3H3 |
| InChIKey | LHKHOGIWCZXRKI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 85.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |