C21H14N4O4 — CID 167198596
3-(4-cyano-2-methoxyphenoxy)-6-(4-cyanophenyl)-5-methylpyridazine-4-carboxylic acid (PubChem CID 167198596) has the molecular formula C21H14N4O4 and a molecular weight of 386.37 g/mol. Its IUPAC name is 3-(4-cyano-2-methoxyphenoxy)-6-(4-cyanophenyl)-5-methylpyridazine-4-carboxylic acid.
| Compound Name | 3-(4-cyano-2-methoxyphenoxy)-6-(4-cyanophenyl)-5-methylpyridazine-4-carboxylic acid |
|---|---|
| PubChem CID | 167198596 |
| Molecular Formula | C21H14N4O4 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 3-(4-cyano-2-methoxyphenoxy)-6-(4-cyanophenyl)-5-methylpyridazine-4-carboxylic acid |
| SMILES | COc1cc(C#N)ccc1Oc1nnc(-c2ccc(C#N)cc2)c(C)c1C(=O)O |
| InChI | InChI=1S/C21H14N4O4/c1-12-18(21(26)27)20(29-16-8-5-14(11-23)9-17(16)28-2)25-24-19(12)15-6-3-13(10-22)4-7-15/h3-9H,1-2H3,(H,26,27) |
| InChIKey | MHXUTVYTWXOLRR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 129.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |