C9H17Cl2NO — CID 170564857
4,5-dichloro-N,N,3,3-tetramethylpentanamide (PubChem CID 170564857) has the molecular formula C9H17Cl2NO and a molecular weight of 226.15 g/mol. Its IUPAC name is 4,5-dichloro-N,N,3,3-tetramethylpentanamide.
| Compound Name | 4,5-dichloro-N,N,3,3-tetramethylpentanamide |
|---|---|
| PubChem CID | 170564857 |
| Molecular Formula | C9H17Cl2NO |
| Molecular Weight | 226.15 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 4,5-dichloro-N,N,3,3-tetramethylpentanamide |
| SMILES | CN(C)C(=O)CC(C)(C)C(Cl)CCl |
| InChI | InChI=1S/C9H17Cl2NO/c1-9(2,7(11)6-10)5-8(13)12(3)4/h7H,5-6H2,1-4H3 |
| InChIKey | PPIGXDSMJBAVMC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.15 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|