C46H40N4 — CID 170567748
7-[4-(1,1,2,2,3,3-hexamethyl-6-phenylinden-5-yl)-6-phenyl-1,3,5-triazin-2-yl]benzo[c]carbazole (PubChem CID 170567748) has the molecular formula C46H40N4 and a molecular weight of 648.85 g/mol. Its IUPAC name is 7-[4-(1,1,2,2,3,3-hexamethyl-6-phenylinden-5-yl)-6-phenyl-1,3,5-triazin-2-yl]benzo[c]carbazole.
| Compound Name | 7-[4-(1,1,2,2,3,3-hexamethyl-6-phenylinden-5-yl)-6-phenyl-1,3,5-triazin-2-yl]benzo[c]carbazole |
|---|---|
| PubChem CID | 170567748 |
| Molecular Formula | C46H40N4 |
| Molecular Weight | 648.85 g/mol |
| Exact Mass | 648.33 |
| IUPAC Name | 7-[4-(1,1,2,2,3,3-hexamethyl-6-phenylinden-5-yl)-6-phenyl-1,3,5-triazin-2-yl]benzo[c]carbazole |
| SMILES | CC1(C)c2cc(-c3ccccc3)c(-c3nc(-c4ccccc4)nc(-n4c5ccccc5c5c6ccccc6ccc54)n3)cc2C(C)(C)C1(C)C |
| InChI | InChI=1S/C46H40N4/c1-44(2)36-27-34(29-17-9-7-10-18-29)35(28-37(36)45(3,4)46(44,5)6)42-47-41(31-20-11-8-12-21-31)48-43(49-42)50-38-24-16-15-23-33(38)40-32-22-14-13-19-30(32)25-26-39(40)50/h7-28H,1-6H3 |
| InChIKey | RURRLZRZIJPQPX-UHFFFAOYSA-N |
| XLogP | 11.72 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.85 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |