C54H46N4 — CID 170567720
4-[6-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,1,2,2,3,3-hexamethylinden-5-yl]-9-phenylcarbazole (PubChem CID 170567720) has the molecular formula C54H46N4 and a molecular weight of 750.99 g/mol. Its IUPAC name is 4-[6-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,1,2,2,3,3-hexamethylinden-5-yl]-9-phenylcarbazole.
| Compound Name | 4-[6-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,1,2,2,3,3-hexamethylinden-5-yl]-9-phenylcarbazole |
|---|---|
| PubChem CID | 170567720 |
| Molecular Formula | C54H46N4 |
| Molecular Weight | 750.99 g/mol |
| Exact Mass | 750.37 |
| IUPAC Name | 4-[6-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,1,2,2,3,3-hexamethylinden-5-yl]-9-phenylcarbazole |
| SMILES | CC1(C)c2cc(-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)c(-c3cccc4c3c3ccccc3n4-c3ccccc3)cc2C(C)(C)C1(C)C |
| InChI | InChI=1S/C54H46N4/c1-52(2)44-33-42(35-29-31-38(32-30-35)51-56-49(36-19-10-7-11-20-36)55-50(57-51)37-21-12-8-13-22-37)43(34-45(44)53(3,4)54(52,5)6)40-26-18-28-47-48(40)41-25-16-17-27-46(41)58(47)39-23-14-9-15-24-39/h7-34H,1-6H3 |
| InChIKey | LHZMYANADWZDHQ-UHFFFAOYSA-N |
| XLogP | 13.90 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.99 |
| LogP ≤ 5 | 13.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |