C60H49N5 — CID 167267779
12-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-11-[4-(1,1,2,2,3,3-hexamethylinden-4-yl)phenyl]indolo[2,3-a]carbazole (PubChem CID 167267779) has the molecular formula C60H49N5 and a molecular weight of 840.09 g/mol. Its IUPAC name is 12-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-11-[4-(1,1,2,2,3,3-hexamethylinden-4-yl)phenyl]indolo[2,3-a]carbazole.
| Compound Name | 12-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-11-[4-(1,1,2,2,3,3-hexamethylinden-4-yl)phenyl]indolo[2,3-a]carbazole |
|---|---|
| PubChem CID | 167267779 |
| Molecular Formula | C60H49N5 |
| Molecular Weight | 840.09 g/mol |
| Exact Mass | 839.40 |
| IUPAC Name | 12-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-11-[4-(1,1,2,2,3,3-hexamethylinden-4-yl)phenyl]indolo[2,3-a]carbazole |
| SMILES | CC1(C)c2cccc(-c3ccc(-n4c5ccccc5c5ccc6c7ccccc7n(-c7ccc(-c8nc(-c9ccccc9)nc(-c9ccccc9)n8)cc7)c6c54)cc3)c2C(C)(C)C1(C)C |
| InChI | InChI=1S/C60H49N5/c1-58(2)49-25-17-24-44(52(49)59(3,4)60(58,5)6)38-28-32-42(33-29-38)64-50-26-15-13-22-45(50)47-36-37-48-46-23-14-16-27-51(46)65(54(48)53(47)64)43-34-30-41(31-35-43)57-62-55(39-18-9-7-10-19-39)61-56(63-57)40-20-11-8-12-21-40/h7-37H,1-6H3 |
| InChIKey | UIFCDQDEUXBMPX-UHFFFAOYSA-N |
| XLogP | 15.33 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.09 |
| LogP ≤ 5 | 15.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |