C64H51N5 — CID 167268014
11-[4-[3-(1,1,2,2,3,3-hexamethylinden-4-yl)phenyl]phenyl]-12-(4-naphthalen-1-yl-6-phenyl-1,3,5-triazin-2-yl)indolo[2,3-a]carbazole (PubChem CID 167268014) has the molecular formula C64H51N5 and a molecular weight of 890.15 g/mol. Its IUPAC name is 11-[4-[3-(1,1,2,2,3,3-hexamethylinden-4-yl)phenyl]phenyl]-12-(4-naphthalen-1-yl-6-phenyl-1,3,5-triazin-2-yl)indolo[2,3-a]carbazole.
| Compound Name | 11-[4-[3-(1,1,2,2,3,3-hexamethylinden-4-yl)phenyl]phenyl]-12-(4-naphthalen-1-yl-6-phenyl-1,3,5-triazin-2-yl)indolo[2,3-a]carbazole |
|---|---|
| PubChem CID | 167268014 |
| Molecular Formula | C64H51N5 |
| Molecular Weight | 890.15 g/mol |
| Exact Mass | 889.41 |
| IUPAC Name | 11-[4-[3-(1,1,2,2,3,3-hexamethylinden-4-yl)phenyl]phenyl]-12-(4-naphthalen-1-yl-6-phenyl-1,3,5-triazin-2-yl)indolo[2,3-a]carbazole |
| SMILES | CC1(C)c2cccc(-c3cccc(-c4ccc(-n5c6ccccc6c6ccc7c8ccccc8n(-c8nc(-c9ccccc9)nc(-c9cccc%10ccccc9%10)n8)c7c65)cc4)c3)c2C(C)(C)C1(C)C |
| InChI | InChI=1S/C64H51N5/c1-62(2)53-30-18-28-47(56(53)63(3,4)64(62,5)6)44-24-16-23-43(39-44)40-33-35-45(36-34-40)68-54-31-14-12-26-48(54)50-37-38-51-49-27-13-15-32-55(49)69(58(51)57(50)68)61-66-59(42-20-8-7-9-21-42)65-60(67-61)52-29-17-22-41-19-10-11-25-46(41)52/h7-39H,1-6H3 |
| InChIKey | QQBYROHEKUMLIH-UHFFFAOYSA-N |
| XLogP | 16.48 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 890.15 |
| LogP ≤ 5 | 16.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |