C18H34F2N2 — CID 170569488
3-[3,3-difluoro-4-(5-methylhexyl)piperidin-1-yl]-N-propan-2-ylprop-1-en-2-amine (PubChem CID 170569488) has the molecular formula C18H34F2N2 and a molecular weight of 316.48 g/mol. Its IUPAC name is 3-[3,3-difluoro-4-(5-methylhexyl)piperidin-1-yl]-N-propan-2-ylprop-1-en-2-amine.
| Compound Name | 3-[3,3-difluoro-4-(5-methylhexyl)piperidin-1-yl]-N-propan-2-ylprop-1-en-2-amine |
|---|---|
| PubChem CID | 170569488 |
| Molecular Formula | C18H34F2N2 |
| Molecular Weight | 316.48 g/mol |
| Exact Mass | 316.27 |
| IUPAC Name | 3-[3,3-difluoro-4-(5-methylhexyl)piperidin-1-yl]-N-propan-2-ylprop-1-en-2-amine |
| SMILES | C=C(CN1CCC(CCCCC(C)C)C(F)(F)C1)NC(C)C |
| InChI | InChI=1S/C18H34F2N2/c1-14(2)8-6-7-9-17-10-11-22(13-18(17,19)20)12-16(5)21-15(3)4/h14-15,17,21H,5-13H2,1-4H3 |
| InChIKey | ZKHFDLKSVCKYNU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.48 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|