About 3-(8-azaspiro[4.5]decan-8-yl)-N-propan-2-ylprop-1-en-2-amine;ethane;2-methylpentane
3-(8-azaspiro[4.5]decan-8-yl)-N-propan-2-ylprop-1-en-2-amine;ethane;2-methylpentane (PubChem CID 170569656) has the molecular formula C23H48N2
and a molecular weight of 352.65 g/mol. Its IUPAC name is 3-(8-azaspiro[4.5]decan-8-yl)-N-propan-2-ylprop-1-en-2-amine;ethane;2-methylpentane.
Molecular Properties
| Compound Name | 3-(8-azaspiro[4.5]decan-8-yl)-N-propan-2-ylprop-1-en-2-amine;ethane;2-methylpentane |
| PubChem CID | 170569656 |
| Molecular Formula | C23H48N2 |
| Molecular Weight | 352.65 g/mol |
| Exact Mass | 352.38 |
| IUPAC Name | 3-(8-azaspiro[4.5]decan-8-yl)-N-propan-2-ylprop-1-en-2-amine;ethane;2-methylpentane |
| SMILES | C=C(CN1CCC2(CCCC2)CC1)NC(C)C.CC.CCCC(C)C |
| InChI | InChI=1S/C15H28N2.C6H14.C2H6/c1-13(2)16-14(3)12-17-10-8-15(9-11-17)6-4-5-7-15;1-4-5-6(2)3;1-2/h13,16H,3-12H2,1-2H3;6H,4-5H2,1-3H3;1-2H3 |
| InChIKey | MDYFDLSDTNHUJW-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.65 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(8-azaspiro[4.5]decan-8-yl)-N-propan-2-ylprop-1-en-2-amine;ethane;2-methylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(8-azaspiro[4.5]decan-8-yl)-N-propan-2-ylprop-1-en-2-amine;ethane;2-methylpentane?
The IUPAC name of 3-(8-azaspiro[4.5]decan-8-yl)-N-propan-2-ylprop-1-en-2-amine;ethane;2-methylpentane (CID 170569656) is 3-(8-azaspiro[4.5]decan-8-yl)-N-propan-2-ylprop-1-en-2-amine;ethane;2-methylpentane.
What is the SMILES notation for 3-(8-azaspiro[4.5]decan-8-yl)-N-propan-2-ylprop-1-en-2-amine;ethane;2-methylpentane?
The canonical SMILES for 3-(8-azaspiro[4.5]decan-8-yl)-N-propan-2-ylprop-1-en-2-amine;ethane;2-methylpentane is C=C(CN1CCC2(CCCC2)CC1)NC(C)C.CC.CCCC(C)C.
What is the InChIKey of 3-(8-azaspiro[4.5]decan-8-yl)-N-propan-2-ylprop-1-en-2-amine;ethane;2-methylpentane?
The InChIKey is MDYFDLSDTNHUJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2.C6H14.C2H6/c1-13(2)16-14(3)12-17-10-8-15(9-11-17)6-4-5-7-15;1-4-5-6(2)3;1-2/h13,16H,3-12H2,1-2H3;6H,4-5H2,1-3H3;1-2H3.
What are the key properties of 3-(8-azaspiro[4.5]decan-8-yl)-N-propan-2-ylprop-1-en-2-amine;ethane;2-methylpentane?
3-(8-azaspiro[4.5]decan-8-yl)-N-propan-2-ylprop-1-en-2-amine;ethane;2-methylpentane has a molecular weight of 352.65 g/mol, XLogP of 6.62, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(8-azaspiro[4.5]decan-8-yl)-N-propan-2-ylprop-1-en-2-amine;ethane;2-methylpentane is sourced from PubChem (CID 170569656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).