About ethyl 2-[amino-[(E)-4-[ethyl(propyl)amino]-4-oxobut-2-enoyl]amino]acetate;methanol
ethyl 2-[amino-[(E)-4-[ethyl(propyl)amino]-4-oxobut-2-enoyl]amino]acetate;methanol (PubChem CID 170570546) has the molecular formula C14H27N3O5
and a molecular weight of 317.39 g/mol. Its IUPAC name is ethyl 2-[amino-[(E)-4-[ethyl(propyl)amino]-4-oxobut-2-enoyl]amino]acetate;methanol.
Molecular Properties
| Compound Name | ethyl 2-[amino-[(E)-4-[ethyl(propyl)amino]-4-oxobut-2-enoyl]amino]acetate;methanol |
| PubChem CID | 170570546 |
| Molecular Formula | C14H27N3O5 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | ethyl 2-[amino-[(E)-4-[ethyl(propyl)amino]-4-oxobut-2-enoyl]amino]acetate;methanol |
| SMILES | CCCN(CC)C(=O)/C=C/C(=O)N(N)CC(=O)OCC.CO |
| InChI | InChI=1S/C13H23N3O4.CH4O/c1-4-9-15(5-2)11(17)7-8-12(18)16(14)10-13(19)20-6-3;1-2/h7-8H,4-6,9-10,14H2,1-3H3;2H,1H3/b8-7+; |
| InChIKey | YVQXIMVHYABTAR-USRGLUTNSA-N |
| XLogP | -0.32 |
| TPSA | 113.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[amino-[(E)-4-[ethyl(propyl)amino]-4-oxobut-2-enoyl]amino]acetate;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[amino-[(E)-4-[ethyl(propyl)amino]-4-oxobut-2-enoyl]amino]acetate;methanol?
The IUPAC name of ethyl 2-[amino-[(E)-4-[ethyl(propyl)amino]-4-oxobut-2-enoyl]amino]acetate;methanol (CID 170570546) is ethyl 2-[amino-[(E)-4-[ethyl(propyl)amino]-4-oxobut-2-enoyl]amino]acetate;methanol.
What is the SMILES notation for ethyl 2-[amino-[(E)-4-[ethyl(propyl)amino]-4-oxobut-2-enoyl]amino]acetate;methanol?
The canonical SMILES for ethyl 2-[amino-[(E)-4-[ethyl(propyl)amino]-4-oxobut-2-enoyl]amino]acetate;methanol is CCCN(CC)C(=O)/C=C/C(=O)N(N)CC(=O)OCC.CO.
What is the InChIKey of ethyl 2-[amino-[(E)-4-[ethyl(propyl)amino]-4-oxobut-2-enoyl]amino]acetate;methanol?
The InChIKey is YVQXIMVHYABTAR-USRGLUTNSA-N. The full InChI is InChI=1S/C13H23N3O4.CH4O/c1-4-9-15(5-2)11(17)7-8-12(18)16(14)10-13(19)20-6-3;1-2/h7-8H,4-6,9-10,14H2,1-3H3;2H,1H3/b8-7+;.
What are the key properties of ethyl 2-[amino-[(E)-4-[ethyl(propyl)amino]-4-oxobut-2-enoyl]amino]acetate;methanol?
ethyl 2-[amino-[(E)-4-[ethyl(propyl)amino]-4-oxobut-2-enoyl]amino]acetate;methanol has a molecular weight of 317.39 g/mol, XLogP of -0.32, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[amino-[(E)-4-[ethyl(propyl)amino]-4-oxobut-2-enoyl]amino]acetate;methanol is sourced from PubChem (CID 170570546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).