About 2-[amino-[(E)-4-oxo-4-piperidin-1-ylbut-2-enoyl]amino]acetic acid;methanol
2-[amino-[(E)-4-oxo-4-piperidin-1-ylbut-2-enoyl]amino]acetic acid;methanol (PubChem CID 170570548) has the molecular formula C12H21N3O5
and a molecular weight of 287.32 g/mol. Its IUPAC name is 2-[amino-[(E)-4-oxo-4-piperidin-1-ylbut-2-enoyl]amino]acetic acid;methanol.
Molecular Properties
| Compound Name | 2-[amino-[(E)-4-oxo-4-piperidin-1-ylbut-2-enoyl]amino]acetic acid;methanol |
| PubChem CID | 170570548 |
| Molecular Formula | C12H21N3O5 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 2-[amino-[(E)-4-oxo-4-piperidin-1-ylbut-2-enoyl]amino]acetic acid;methanol |
| SMILES | CO.NN(CC(=O)O)C(=O)/C=C/C(=O)N1CCCCC1 |
| InChI | InChI=1S/C11H17N3O4.CH4O/c12-14(8-11(17)18)10(16)5-4-9(15)13-6-2-1-3-7-13;1-2/h4-5H,1-3,6-8,12H2,(H,17,18);2H,1H3/b5-4+; |
| InChIKey | XQGUPKFAPDACNM-FXRZFVDSSA-N |
| XLogP | -1.05 |
| TPSA | 124.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[amino-[(E)-4-oxo-4-piperidin-1-ylbut-2-enoyl]amino]acetic acid;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[amino-[(E)-4-oxo-4-piperidin-1-ylbut-2-enoyl]amino]acetic acid;methanol?
The IUPAC name of 2-[amino-[(E)-4-oxo-4-piperidin-1-ylbut-2-enoyl]amino]acetic acid;methanol (CID 170570548) is 2-[amino-[(E)-4-oxo-4-piperidin-1-ylbut-2-enoyl]amino]acetic acid;methanol.
What is the SMILES notation for 2-[amino-[(E)-4-oxo-4-piperidin-1-ylbut-2-enoyl]amino]acetic acid;methanol?
The canonical SMILES for 2-[amino-[(E)-4-oxo-4-piperidin-1-ylbut-2-enoyl]amino]acetic acid;methanol is CO.NN(CC(=O)O)C(=O)/C=C/C(=O)N1CCCCC1.
What is the InChIKey of 2-[amino-[(E)-4-oxo-4-piperidin-1-ylbut-2-enoyl]amino]acetic acid;methanol?
The InChIKey is XQGUPKFAPDACNM-FXRZFVDSSA-N. The full InChI is InChI=1S/C11H17N3O4.CH4O/c12-14(8-11(17)18)10(16)5-4-9(15)13-6-2-1-3-7-13;1-2/h4-5H,1-3,6-8,12H2,(H,17,18);2H,1H3/b5-4+;.
What are the key properties of 2-[amino-[(E)-4-oxo-4-piperidin-1-ylbut-2-enoyl]amino]acetic acid;methanol?
2-[amino-[(E)-4-oxo-4-piperidin-1-ylbut-2-enoyl]amino]acetic acid;methanol has a molecular weight of 287.32 g/mol, XLogP of -1.05, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[amino-[(E)-4-oxo-4-piperidin-1-ylbut-2-enoyl]amino]acetic acid;methanol is sourced from PubChem (CID 170570548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).