C17H26N2O4 — CID 170570599
ethene;2-[[(E)-4-[[(E)-2-ethenylbut-2-enyl]amino]-4-oxobut-2-enoyl]-propan-2-ylamino]acetic acid (PubChem CID 170570599) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is ethene;2-[[(E)-4-[[(E)-2-ethenylbut-2-enyl]amino]-4-oxobut-2-enoyl]-propan-2-ylamino]acetic acid.
| Compound Name | ethene;2-[[(E)-4-[[(E)-2-ethenylbut-2-enyl]amino]-4-oxobut-2-enoyl]-propan-2-ylamino]acetic acid |
|---|---|
| PubChem CID | 170570599 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | ethene;2-[[(E)-4-[[(E)-2-ethenylbut-2-enyl]amino]-4-oxobut-2-enoyl]-propan-2-ylamino]acetic acid |
| SMILES | C=C.C=C/C(=C\C)CNC(=O)/C=C/C(=O)N(CC(=O)O)C(C)C |
| InChI | InChI=1S/C15H22N2O4.C2H4/c1-5-12(6-2)9-16-13(18)7-8-14(19)17(11(3)4)10-15(20)21;1-2/h5-8,11H,1,9-10H2,2-4H3,(H,16,18)(H,20,21);1-2H2/b8-7+,12-6+; |
| InChIKey | MIQKQLHAIDJLSH-BVMHRPFYSA-N |
| XLogP | 1.91 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|