About 7-bromo-6-chloro-4-(1,7-diazaspiro[3.4]octan-7-yl)-8-fluoro-2-methoxyquinazoline
7-bromo-6-chloro-4-(1,7-diazaspiro[3.4]octan-7-yl)-8-fluoro-2-methoxyquinazoline (PubChem CID 170572041) has the molecular formula C15H15BrClFN4O
and a molecular weight of 401.67 g/mol. Its IUPAC name is 7-bromo-6-chloro-4-(1,7-diazaspiro[3.4]octan-7-yl)-8-fluoro-2-methoxyquinazoline.
Molecular Properties
| Compound Name | 7-bromo-6-chloro-4-(1,7-diazaspiro[3.4]octan-7-yl)-8-fluoro-2-methoxyquinazoline |
| PubChem CID | 170572041 |
| Molecular Formula | C15H15BrClFN4O |
| Molecular Weight | 401.67 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | 7-bromo-6-chloro-4-(1,7-diazaspiro[3.4]octan-7-yl)-8-fluoro-2-methoxyquinazoline |
| SMILES | COc1nc(N2CCC3(CCN3)C2)c2cc(Cl)c(Br)c(F)c2n1 |
| InChI | InChI=1S/C15H15BrClFN4O/c1-23-14-20-12-8(6-9(17)10(16)11(12)18)13(21-14)22-5-3-15(7-22)2-4-19-15/h6,19H,2-5,7H2,1H3 |
| InChIKey | UTULWXBYSXCDKT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.67 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-6-chloro-4-(1,7-diazaspiro[3.4]octan-7-yl)-8-fluoro-2-methoxyquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-6-chloro-4-(1,7-diazaspiro[3.4]octan-7-yl)-8-fluoro-2-methoxyquinazoline?
The IUPAC name of 7-bromo-6-chloro-4-(1,7-diazaspiro[3.4]octan-7-yl)-8-fluoro-2-methoxyquinazoline (CID 170572041) is 7-bromo-6-chloro-4-(1,7-diazaspiro[3.4]octan-7-yl)-8-fluoro-2-methoxyquinazoline.
What is the SMILES notation for 7-bromo-6-chloro-4-(1,7-diazaspiro[3.4]octan-7-yl)-8-fluoro-2-methoxyquinazoline?
The canonical SMILES for 7-bromo-6-chloro-4-(1,7-diazaspiro[3.4]octan-7-yl)-8-fluoro-2-methoxyquinazoline is COc1nc(N2CCC3(CCN3)C2)c2cc(Cl)c(Br)c(F)c2n1.
What is the InChIKey of 7-bromo-6-chloro-4-(1,7-diazaspiro[3.4]octan-7-yl)-8-fluoro-2-methoxyquinazoline?
The InChIKey is UTULWXBYSXCDKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15BrClFN4O/c1-23-14-20-12-8(6-9(17)10(16)11(12)18)13(21-14)22-5-3-15(7-22)2-4-19-15/h6,19H,2-5,7H2,1H3.
What are the key properties of 7-bromo-6-chloro-4-(1,7-diazaspiro[3.4]octan-7-yl)-8-fluoro-2-methoxyquinazoline?
7-bromo-6-chloro-4-(1,7-diazaspiro[3.4]octan-7-yl)-8-fluoro-2-methoxyquinazoline has a molecular weight of 401.67 g/mol, XLogP of 3.14, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-6-chloro-4-(1,7-diazaspiro[3.4]octan-7-yl)-8-fluoro-2-methoxyquinazoline is sourced from PubChem (CID 170572041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).