C26H41N5O3 — CID 170572527
N-methylmethanamine;2-[3-methyl-2-oxo-4-[1-(piperidin-4-ylmethyl)piperidin-4-yl]benzimidazol-1-yl]pentanedial (PubChem CID 170572527) has the molecular formula C26H41N5O3 and a molecular weight of 471.65 g/mol. Its IUPAC name is N-methylmethanamine;2-[3-methyl-2-oxo-4-[1-(piperidin-4-ylmethyl)piperidin-4-yl]benzimidazol-1-yl]pentanedial.
| Compound Name | N-methylmethanamine;2-[3-methyl-2-oxo-4-[1-(piperidin-4-ylmethyl)piperidin-4-yl]benzimidazol-1-yl]pentanedial |
|---|---|
| PubChem CID | 170572527 |
| Molecular Formula | C26H41N5O3 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.32 |
| IUPAC Name | N-methylmethanamine;2-[3-methyl-2-oxo-4-[1-(piperidin-4-ylmethyl)piperidin-4-yl]benzimidazol-1-yl]pentanedial |
| SMILES | CNC.Cn1c(=O)n(C(C=O)CCC=O)c2cccc(C3CCN(CC4CCNCC4)CC3)c21 |
| InChI | InChI=1S/C24H34N4O3.C2H7N/c1-26-23-21(19-9-13-27(14-10-19)16-18-7-11-25-12-8-18)5-2-6-22(23)28(24(26)31)20(17-30)4-3-15-29;1-3-2/h2,5-6,15,17-20,25H,3-4,7-14,16H2,1H3;3H,1-2H3 |
| InChIKey | VJLNNRGCGGWWCV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|