C25H35N5O3 — CID 170320387
1-methyl-3-[3-methyl-2-oxo-4-[1-(piperidin-4-ylmethyl)piperidin-4-yl]benzimidazol-1-yl]piperidine-2,6-dione (PubChem CID 170320387) has the molecular formula C25H35N5O3 and a molecular weight of 453.59 g/mol. Its IUPAC name is 1-methyl-3-[3-methyl-2-oxo-4-[1-(piperidin-4-ylmethyl)piperidin-4-yl]benzimidazol-1-yl]piperidine-2,6-dione.
| Compound Name | 1-methyl-3-[3-methyl-2-oxo-4-[1-(piperidin-4-ylmethyl)piperidin-4-yl]benzimidazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170320387 |
| Molecular Formula | C25H35N5O3 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | 1-methyl-3-[3-methyl-2-oxo-4-[1-(piperidin-4-ylmethyl)piperidin-4-yl]benzimidazol-1-yl]piperidine-2,6-dione |
| SMILES | CN1C(=O)CCC(n2c(=O)n(C)c3c(C4CCN(CC5CCNCC5)CC4)cccc32)C1=O |
| InChI | InChI=1S/C25H35N5O3/c1-27-22(31)7-6-21(24(27)32)30-20-5-3-4-19(23(20)28(2)25(30)33)18-10-14-29(15-11-18)16-17-8-12-26-13-9-17/h3-5,17-18,21,26H,6-16H2,1-2H3 |
| InChIKey | XJAIPHGCFCWODF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 79.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|