C15H17N3O3 — CID 171554865
3-(3,4-dimethyl-2-oxobenzimidazol-1-yl)-1-methylpiperidine-2,6-dione (PubChem CID 171554865) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 3-(3,4-dimethyl-2-oxobenzimidazol-1-yl)-1-methylpiperidine-2,6-dione.
| Compound Name | 3-(3,4-dimethyl-2-oxobenzimidazol-1-yl)-1-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 171554865 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 3-(3,4-dimethyl-2-oxobenzimidazol-1-yl)-1-methylpiperidine-2,6-dione |
| SMILES | Cc1cccc2c1n(C)c(=O)n2C1CCC(=O)N(C)C1=O |
| InChI | InChI=1S/C15H17N3O3/c1-9-5-4-6-10-13(9)17(3)15(21)18(10)11-7-8-12(19)16(2)14(11)20/h4-6,11H,7-8H2,1-3H3 |
| InChIKey | BNHCPGFDQLHIAE-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 64.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|