C22H30N4O4 — CID 146599446
1-methyl-3-[3-methyl-2-oxo-4-(3-piperidin-4-yloxypropyl)benzimidazol-1-yl]piperidine-2,6-dione (PubChem CID 146599446) has the molecular formula C22H30N4O4 and a molecular weight of 414.51 g/mol. Its IUPAC name is 1-methyl-3-[3-methyl-2-oxo-4-(3-piperidin-4-yloxypropyl)benzimidazol-1-yl]piperidine-2,6-dione.
| Compound Name | 1-methyl-3-[3-methyl-2-oxo-4-(3-piperidin-4-yloxypropyl)benzimidazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146599446 |
| Molecular Formula | C22H30N4O4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 1-methyl-3-[3-methyl-2-oxo-4-(3-piperidin-4-yloxypropyl)benzimidazol-1-yl]piperidine-2,6-dione |
| SMILES | CN1C(=O)CCC(n2c(=O)n(C)c3c(CCCOC4CCNCC4)cccc32)C1=O |
| InChI | InChI=1S/C22H30N4O4/c1-24-19(27)9-8-18(21(24)28)26-17-7-3-5-15(20(17)25(2)22(26)29)6-4-14-30-16-10-12-23-13-11-16/h3,5,7,16,18,23H,4,6,8-14H2,1-2H3 |
| InChIKey | PWFZANVMCQYXAP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 85.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|