C33H31BF2N6O4 — CID 170572652
CID 170572652 (PubChem CID 170572652) has the molecular formula C33H31BF2N6O4 and a molecular weight of 624.46 g/mol.
| Compound Name | CID 170572652 |
|---|---|
| PubChem CID | 170572652 |
| Molecular Formula | C33H31BF2N6O4 |
| Molecular Weight | 624.46 g/mol |
| Exact Mass | 624.25 |
| IUPAC Name | — |
| SMILES | [B]C1CN2C(O)(O)CCC2(COc2nc(N3CC4CCC3CN4)c3cnc(-c4cc(O)cc5ccc(F)c(C#C)c45)c(F)c3n2)C1 |
| InChI | InChI=1S/C33H31BF2N6O4/c1-2-22-25(35)6-3-17-9-21(43)10-23(26(17)22)28-27(36)29-24(13-38-28)30(41-15-19-4-5-20(41)12-37-19)40-31(39-29)46-16-32-7-8-33(44,45)42(32)14-18(34)11-32/h1,3,6,9-10,13,18-20,37,43-45H,4-5,7-8,11-12,14-16H2 |
| InChIKey | SHRYFPKMEMEAED-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 127.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|