C14H30N2O2 — CID 170573642
ethane;1-(4-ethyl-3-methoxypyrazol-1-yl)-2-methylpropan-2-ol (PubChem CID 170573642) has the molecular formula C14H30N2O2 and a molecular weight of 258.41 g/mol. Its IUPAC name is ethane;1-(4-ethyl-3-methoxypyrazol-1-yl)-2-methylpropan-2-ol.
| Compound Name | ethane;1-(4-ethyl-3-methoxypyrazol-1-yl)-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 170573642 |
| Molecular Formula | C14H30N2O2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | ethane;1-(4-ethyl-3-methoxypyrazol-1-yl)-2-methylpropan-2-ol |
| SMILES | CC.CC.CCc1cn(CC(C)(C)O)nc1OC |
| InChI | InChI=1S/C10H18N2O2.2C2H6/c1-5-8-6-12(7-10(2,3)13)11-9(8)14-4;2*1-2/h6,13H,5,7H2,1-4H3;2*1-2H3 |
| InChIKey | IBSLBWMOQBNLKV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |