C17H26N4O2 — CID 170574669
6-ethyl-4-[1-(2-methoxyethyl)pyrazol-4-yl]pyridine-2-carboxamide;propane (PubChem CID 170574669) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 6-ethyl-4-[1-(2-methoxyethyl)pyrazol-4-yl]pyridine-2-carboxamide;propane.
| Compound Name | 6-ethyl-4-[1-(2-methoxyethyl)pyrazol-4-yl]pyridine-2-carboxamide;propane |
|---|---|
| PubChem CID | 170574669 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 6-ethyl-4-[1-(2-methoxyethyl)pyrazol-4-yl]pyridine-2-carboxamide;propane |
| SMILES | CCC.CCc1cc(-c2cnn(CCOC)c2)cc(C(N)=O)n1 |
| InChI | InChI=1S/C14H18N4O2.C3H8/c1-3-12-6-10(7-13(17-12)14(15)19)11-8-16-18(9-11)4-5-20-2;1-3-2/h6-9H,3-5H2,1-2H3,(H2,15,19);3H2,1-2H3 |
| InChIKey | OASGKHKYGHVGRO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |