C16H22N2O2 — CID 172876868
[4-[1-(3-methoxypropyl)pyrazol-4-yl]-2,6-dimethylphenyl]methanol (PubChem CID 172876868) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is [4-[1-(3-methoxypropyl)pyrazol-4-yl]-2,6-dimethylphenyl]methanol.
| Compound Name | [4-[1-(3-methoxypropyl)pyrazol-4-yl]-2,6-dimethylphenyl]methanol |
|---|---|
| PubChem CID | 172876868 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | [4-[1-(3-methoxypropyl)pyrazol-4-yl]-2,6-dimethylphenyl]methanol |
| SMILES | COCCCn1cc(-c2cc(C)c(CO)c(C)c2)cn1 |
| InChI | InChI=1S/C16H22N2O2/c1-12-7-14(8-13(2)16(12)11-19)15-9-17-18(10-15)5-4-6-20-3/h7-10,19H,4-6,11H2,1-3H3 |
| InChIKey | YKJCMNXCOHNKMF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|