C21H27BN2O5 — CID 170575074
(3R)-3-hydroxy-1-methyl-3-[3-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2-oxazol-5-yl]pyrrolidin-2-one (PubChem CID 170575074) has the molecular formula C21H27BN2O5 and a molecular weight of 398.27 g/mol. Its IUPAC name is (3R)-3-hydroxy-1-methyl-3-[3-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2-oxazol-5-yl]pyrrolidin-2-one.
| Compound Name | (3R)-3-hydroxy-1-methyl-3-[3-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2-oxazol-5-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 170575074 |
| Molecular Formula | C21H27BN2O5 |
| Molecular Weight | 398.27 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | (3R)-3-hydroxy-1-methyl-3-[3-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2-oxazol-5-yl]pyrrolidin-2-one |
| SMILES | Cc1ccc(B2OC(C)(C)C(C)(C)O2)cc1-c1cc([C@]2(O)CCN(C)C2=O)on1 |
| InChI | InChI=1S/C21H27BN2O5/c1-13-7-8-14(22-28-19(2,3)20(4,5)29-22)11-15(13)16-12-17(27-23-16)21(26)9-10-24(6)18(21)25/h7-8,11-12,26H,9-10H2,1-6H3/t21-/m1/s1 |
| InChIKey | GFGHDVDKEFHZOT-OAQYLSRUSA-N |
| XLogP | 2.00 |
| TPSA | 85.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|