About ethane;N-hydroxy-N'-(4-methyl-2-pyridinyl)methanimidamide
ethane;N-hydroxy-N'-(4-methyl-2-pyridinyl)methanimidamide (PubChem CID 170575859) has the molecular formula C9H15N3O
and a molecular weight of 181.24 g/mol. Its IUPAC name is ethane;N-hydroxy-N'-(4-methyl-2-pyridinyl)methanimidamide.
Molecular Properties
| Compound Name | ethane;N-hydroxy-N'-(4-methyl-2-pyridinyl)methanimidamide |
| PubChem CID | 170575859 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | ethane;N-hydroxy-N'-(4-methyl-2-pyridinyl)methanimidamide |
| SMILES | CC.Cc1ccnc(/N=C/NO)c1 |
| InChI | InChI=1S/C7H9N3O.C2H6/c1-6-2-3-8-7(4-6)9-5-10-11;1-2/h2-5,11H,1H3,(H,8,9,10);1-2H3 |
| InChIKey | WACZPBCOFBBIJW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-hydroxy-N'-(4-methyl-2-pyridinyl)methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-hydroxy-N'-(4-methyl-2-pyridinyl)methanimidamide?
The IUPAC name of ethane;N-hydroxy-N'-(4-methyl-2-pyridinyl)methanimidamide (CID 170575859) is ethane;N-hydroxy-N'-(4-methyl-2-pyridinyl)methanimidamide.
What is the SMILES notation for ethane;N-hydroxy-N'-(4-methyl-2-pyridinyl)methanimidamide?
The canonical SMILES for ethane;N-hydroxy-N'-(4-methyl-2-pyridinyl)methanimidamide is CC.Cc1ccnc(/N=C/NO)c1.
What is the InChIKey of ethane;N-hydroxy-N'-(4-methyl-2-pyridinyl)methanimidamide?
The InChIKey is WACZPBCOFBBIJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O.C2H6/c1-6-2-3-8-7(4-6)9-5-10-11;1-2/h2-5,11H,1H3,(H,8,9,10);1-2H3.
What are the key properties of ethane;N-hydroxy-N'-(4-methyl-2-pyridinyl)methanimidamide?
ethane;N-hydroxy-N'-(4-methyl-2-pyridinyl)methanimidamide has a molecular weight of 181.24 g/mol, XLogP of 2.05, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-hydroxy-N'-(4-methyl-2-pyridinyl)methanimidamide is sourced from PubChem (CID 170575859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).