About ethane;methanol;4-methyl-2-methylsulfanylpyridine
ethane;methanol;4-methyl-2-methylsulfanylpyridine (PubChem CID 178057256) has the molecular formula C10H19NOS
and a molecular weight of 201.33 g/mol. Its IUPAC name is ethane;methanol;4-methyl-2-methylsulfanylpyridine.
Molecular Properties
| Compound Name | ethane;methanol;4-methyl-2-methylsulfanylpyridine |
| PubChem CID | 178057256 |
| Molecular Formula | C10H19NOS |
| Molecular Weight | 201.33 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | ethane;methanol;4-methyl-2-methylsulfanylpyridine |
| SMILES | CC.CO.CSc1cc(C)ccn1 |
| InChI | InChI=1S/C7H9NS.C2H6.CH4O/c1-6-3-4-8-7(5-6)9-2;2*1-2/h3-5H,1-2H3;1-2H3;2H,1H3 |
| InChIKey | MCZZPQCXIBXDLB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;methanol;4-methyl-2-methylsulfanylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methanol;4-methyl-2-methylsulfanylpyridine?
The IUPAC name of ethane;methanol;4-methyl-2-methylsulfanylpyridine (CID 178057256) is ethane;methanol;4-methyl-2-methylsulfanylpyridine.
What is the SMILES notation for ethane;methanol;4-methyl-2-methylsulfanylpyridine?
The canonical SMILES for ethane;methanol;4-methyl-2-methylsulfanylpyridine is CC.CO.CSc1cc(C)ccn1.
What is the InChIKey of ethane;methanol;4-methyl-2-methylsulfanylpyridine?
The InChIKey is MCZZPQCXIBXDLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NS.C2H6.CH4O/c1-6-3-4-8-7(5-6)9-2;2*1-2/h3-5H,1-2H3;1-2H3;2H,1H3.
What are the key properties of ethane;methanol;4-methyl-2-methylsulfanylpyridine?
ethane;methanol;4-methyl-2-methylsulfanylpyridine has a molecular weight of 201.33 g/mol, XLogP of 2.75, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methanol;4-methyl-2-methylsulfanylpyridine is sourced from PubChem (CID 178057256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).