C8H9ClF2N2O — CID 170577812
4-chloro-2-(1,1-difluoroethyl)-6-ethoxypyrimidine (PubChem CID 170577812) has the molecular formula C8H9ClF2N2O and a molecular weight of 222.62 g/mol. Its IUPAC name is 4-chloro-2-(1,1-difluoroethyl)-6-ethoxypyrimidine.
| Compound Name | 4-chloro-2-(1,1-difluoroethyl)-6-ethoxypyrimidine |
|---|---|
| PubChem CID | 170577812 |
| Molecular Formula | C8H9ClF2N2O |
| Molecular Weight | 222.62 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | 4-chloro-2-(1,1-difluoroethyl)-6-ethoxypyrimidine |
| SMILES | CCOc1cc(Cl)nc(C(C)(F)F)n1 |
| InChI | InChI=1S/C8H9ClF2N2O/c1-3-14-6-4-5(9)12-7(13-6)8(2,10)11/h4H,3H2,1-2H3 |
| InChIKey | JZTFNIOHNMOCNQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.62 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |