C19H25ClF2O3 — CID 170580974
(4S)-4-(3-chloro-2,6-difluorophenyl)-1-[3-hydroxy-3-(hydroxymethyl)cyclobutyl]-5,5-dimethylhexan-1-one (PubChem CID 170580974) has the molecular formula C19H25ClF2O3 and a molecular weight of 374.86 g/mol. Its IUPAC name is (4S)-4-(3-chloro-2,6-difluorophenyl)-1-[3-hydroxy-3-(hydroxymethyl)cyclobutyl]-5,5-dimethylhexan-1-one.
| Compound Name | (4S)-4-(3-chloro-2,6-difluorophenyl)-1-[3-hydroxy-3-(hydroxymethyl)cyclobutyl]-5,5-dimethylhexan-1-one |
|---|---|
| PubChem CID | 170580974 |
| Molecular Formula | C19H25ClF2O3 |
| Molecular Weight | 374.86 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (4S)-4-(3-chloro-2,6-difluorophenyl)-1-[3-hydroxy-3-(hydroxymethyl)cyclobutyl]-5,5-dimethylhexan-1-one |
| SMILES | CC(C)(C)[C@H](CCC(=O)C1CC(O)(CO)C1)c1c(F)ccc(Cl)c1F |
| InChI | InChI=1S/C19H25ClF2O3/c1-18(2,3)12(16-14(21)6-5-13(20)17(16)22)4-7-15(24)11-8-19(25,9-11)10-23/h5-6,11-12,23,25H,4,7-10H2,1-3H3/t11?,12-,19?/m1/s1 |
| InChIKey | LXSREAZUCRFXPC-DKXWOSEQSA-N |
| XLogP | 4.23 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.86 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|