C20H27ClF2O2 — CID 170579716
(4S)-4-(3-chloro-2,6-difluorophenyl)-1-(3-hydroxy-3-methylcyclopentyl)-5,5-dimethylhexan-1-one (PubChem CID 170579716) has the molecular formula C20H27ClF2O2 and a molecular weight of 372.88 g/mol. Its IUPAC name is (4S)-4-(3-chloro-2,6-difluorophenyl)-1-(3-hydroxy-3-methylcyclopentyl)-5,5-dimethylhexan-1-one.
| Compound Name | (4S)-4-(3-chloro-2,6-difluorophenyl)-1-(3-hydroxy-3-methylcyclopentyl)-5,5-dimethylhexan-1-one |
|---|---|
| PubChem CID | 170579716 |
| Molecular Formula | C20H27ClF2O2 |
| Molecular Weight | 372.88 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | (4S)-4-(3-chloro-2,6-difluorophenyl)-1-(3-hydroxy-3-methylcyclopentyl)-5,5-dimethylhexan-1-one |
| SMILES | CC1(O)CCC(C(=O)CC[C@H](c2c(F)ccc(Cl)c2F)C(C)(C)C)C1 |
| InChI | InChI=1S/C20H27ClF2O2/c1-19(2,3)13(17-15(22)7-6-14(21)18(17)23)5-8-16(24)12-9-10-20(4,25)11-12/h6-7,12-13,25H,5,8-11H2,1-4H3/t12?,13-,20?/m1/s1 |
| InChIKey | NOVSQMFBZFJFQB-DAIAYTDJSA-N |
| XLogP | 5.65 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.88 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|