C14H24N2 — CID 170581317
4-ethyl-3-methyl-2-(3-methylpyrrolidin-1-yl)pyridine;methane (PubChem CID 170581317) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 4-ethyl-3-methyl-2-(3-methylpyrrolidin-1-yl)pyridine;methane.
| Compound Name | 4-ethyl-3-methyl-2-(3-methylpyrrolidin-1-yl)pyridine;methane |
|---|---|
| PubChem CID | 170581317 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 4-ethyl-3-methyl-2-(3-methylpyrrolidin-1-yl)pyridine;methane |
| SMILES | C.CCc1ccnc(N2CCC(C)C2)c1C |
| InChI | InChI=1S/C13H20N2.CH4/c1-4-12-5-7-14-13(11(12)3)15-8-6-10(2)9-15;/h5,7,10H,4,6,8-9H2,1-3H3;1H4 |
| InChIKey | DKFGFDATYFAAQF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |