C11H12ClN3 — CID 107057088
3-chloro-2-(3-methylpyrrolidin-1-yl)pyridine-4-carbonitrile (PubChem CID 107057088) has the molecular formula C11H12ClN3 and a molecular weight of 221.69 g/mol. Its IUPAC name is 3-chloro-2-(3-methylpyrrolidin-1-yl)pyridine-4-carbonitrile.
| Compound Name | 3-chloro-2-(3-methylpyrrolidin-1-yl)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 107057088 |
| Molecular Formula | C11H12ClN3 |
| Molecular Weight | 221.69 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 3-chloro-2-(3-methylpyrrolidin-1-yl)pyridine-4-carbonitrile |
| SMILES | CC1CCN(c2nccc(C#N)c2Cl)C1 |
| InChI | InChI=1S/C11H12ClN3/c1-8-3-5-15(7-8)11-10(12)9(6-13)2-4-14-11/h2,4,8H,3,5,7H2,1H3 |
| InChIKey | ZFMKRKFCBZHBCC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.69 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |