C15H20ClN5 — CID 107061360
2-[3-(4-aminopiperidin-1-yl)pyrrolidin-1-yl]-3-chloropyridine-4-carbonitrile (PubChem CID 107061360) has the molecular formula C15H20ClN5 and a molecular weight of 305.81 g/mol. Its IUPAC name is 2-[3-(4-aminopiperidin-1-yl)pyrrolidin-1-yl]-3-chloropyridine-4-carbonitrile.
| Compound Name | 2-[3-(4-aminopiperidin-1-yl)pyrrolidin-1-yl]-3-chloropyridine-4-carbonitrile |
|---|---|
| PubChem CID | 107061360 |
| Molecular Formula | C15H20ClN5 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 2-[3-(4-aminopiperidin-1-yl)pyrrolidin-1-yl]-3-chloropyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc(N2CCC(N3CCC(N)CC3)C2)c1Cl |
| InChI | InChI=1S/C15H20ClN5/c16-14-11(9-17)1-5-19-15(14)21-8-4-13(10-21)20-6-2-12(18)3-7-20/h1,5,12-13H,2-4,6-8,10,18H2 |
| InChIKey | HSBGFYVRMVMXCR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |