C13H15ClN4O — CID 107058314
N-[1-(3-chloro-4-cyano-2-pyridinyl)piperidin-4-yl]acetamide (PubChem CID 107058314) has the molecular formula C13H15ClN4O and a molecular weight of 278.74 g/mol. Its IUPAC name is N-[1-(3-chloro-4-cyano-2-pyridinyl)piperidin-4-yl]acetamide.
| Compound Name | N-[1-(3-chloro-4-cyano-2-pyridinyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 107058314 |
| Molecular Formula | C13H15ClN4O |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | N-[1-(3-chloro-4-cyano-2-pyridinyl)piperidin-4-yl]acetamide |
| SMILES | CC(=O)NC1CCN(c2nccc(C#N)c2Cl)CC1 |
| InChI | InChI=1S/C13H15ClN4O/c1-9(19)17-11-3-6-18(7-4-11)13-12(14)10(8-15)2-5-16-13/h2,5,11H,3-4,6-7H2,1H3,(H,17,19) |
| InChIKey | VWASSRCBPILXHQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |