C26H20F3N3O5S — CID 170582288
(2R)-2,6-difluoro-N-[[2-(4-fluoro-2-methoxyphenyl)-1,6-naphthyridin-7-yl]methyl]-1,1-dioxo-3,5-dihydro-2H-4,1λ6-benzoxathiepine-8-carboxamide (PubChem CID 170582288) has the molecular formula C26H20F3N3O5S and a molecular weight of 543.52 g/mol. Its IUPAC name is (2R)-2,6-difluoro-N-[[2-(4-fluoro-2-methoxyphenyl)-1,6-naphthyridin-7-yl]methyl]-1,1-dioxo-3,5-dihydro-2H-4,1λ6-benzoxathiepine-8-carboxamide.
| Compound Name | (2R)-2,6-difluoro-N-[[2-(4-fluoro-2-methoxyphenyl)-1,6-naphthyridin-7-yl]methyl]-1,1-dioxo-3,5-dihydro-2H-4,1λ6-benzoxathiepine-8-carboxamide |
|---|---|
| PubChem CID | 170582288 |
| Molecular Formula | C26H20F3N3O5S |
| Molecular Weight | 543.52 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | (2R)-2,6-difluoro-N-[[2-(4-fluoro-2-methoxyphenyl)-1,6-naphthyridin-7-yl]methyl]-1,1-dioxo-3,5-dihydro-2H-4,1λ6-benzoxathiepine-8-carboxamide |
| SMILES | COc1cc(F)ccc1-c1ccc2cnc(CNC(=O)c3cc(F)c4c(c3)S(=O)(=O)[C@@H](F)COC4)cc2n1 |
| InChI | InChI=1S/C26H20F3N3O5S/c1-36-23-8-16(27)3-4-18(23)21-5-2-14-10-30-17(9-22(14)32-21)11-31-26(33)15-6-20(28)19-12-37-13-25(29)38(34,35)24(19)7-15/h2-10,25H,11-13H2,1H3,(H,31,33)/t25-/m1/s1 |
| InChIKey | PHWMKBHZEPEOAJ-RUZDIDTESA-N |
| XLogP | 4.11 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.52 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |