C26H21BBrFN4O6S — CID 170582211
CID 170582211 (PubChem CID 170582211) has the molecular formula C26H21BBrFN4O6S and a molecular weight of 627.26 g/mol.
| Compound Name | CID 170582211 |
|---|---|
| PubChem CID | 170582211 |
| Molecular Formula | C26H21BBrFN4O6S |
| Molecular Weight | 627.26 g/mol |
| Exact Mass | 626.04 |
| IUPAC Name | — |
| SMILES | [B]C(O)(O)c1ccc(-c2ccc3cnc(CNC(=O)c4cc(Br)c5c(c4)S(=O)C(F)COC5)cc3n2)c(OC)n1 |
| InChI | InChI=1S/C26H21BBrFN4O6S/c1-38-25-16(3-5-22(33-25)26(27,35)36)19-4-2-13-9-30-15(8-20(13)32-19)10-31-24(34)14-6-18(28)17-11-39-12-23(29)40(37)21(17)7-14/h2-9,23,35-36H,10-12H2,1H3,(H,31,34) |
| InChIKey | UGMWVLLHPBUNIL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 143.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.26 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|