C28H24ClF3N4O8S — CID 170582222
6-chloro-N-[[2-[6-(1,1-difluoroethyl)-2-(1,1,2,2,2-pentahydroxyethoxy)-3-pyridinyl]-1,6-naphthyridin-7-yl]methyl]-2-fluoro-3,5-dihydro-2H-4,1-benzoxathiepine-8-carboxamide (PubChem CID 170582222) has the molecular formula C28H24ClF3N4O8S and a molecular weight of 669.03 g/mol. Its IUPAC name is 6-chloro-N-[[2-[6-(1,1-difluoroethyl)-2-(1,1,2,2,2-pentahydroxyethoxy)-3-pyridinyl]-1,6-naphthyridin-7-yl]methyl]-2-fluoro-3,5-dihydro-2H-4,1-benzoxathiepine-8-carboxamide.
| Compound Name | 6-chloro-N-[[2-[6-(1,1-difluoroethyl)-2-(1,1,2,2,2-pentahydroxyethoxy)-3-pyridinyl]-1,6-naphthyridin-7-yl]methyl]-2-fluoro-3,5-dihydro-2H-4,1-benzoxathiepine-8-carboxamide |
|---|---|
| PubChem CID | 170582222 |
| Molecular Formula | C28H24ClF3N4O8S |
| Molecular Weight | 669.03 g/mol |
| Exact Mass | 668.10 |
| IUPAC Name | 6-chloro-N-[[2-[6-(1,1-difluoroethyl)-2-(1,1,2,2,2-pentahydroxyethoxy)-3-pyridinyl]-1,6-naphthyridin-7-yl]methyl]-2-fluoro-3,5-dihydro-2H-4,1-benzoxathiepine-8-carboxamide |
| SMILES | CC(F)(F)c1ccc(-c2ccc3cnc(CNC(=O)c4cc(Cl)c5c(c4)SC(F)COC5)cc3n2)c(OC(O)(O)C(O)(O)O)n1 |
| InChI | InChI=1S/C28H24ClF3N4O8S/c1-26(31,32)22-5-3-16(25(36-22)44-28(41,42)27(38,39)40)19-4-2-13-9-33-15(8-20(13)35-19)10-34-24(37)14-6-18(29)17-11-43-12-23(30)45-21(17)7-14/h2-9,23,38-42H,10-12H2,1H3,(H,34,37) |
| InChIKey | GDOIDROTDLDBBZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 187.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.03 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|