C29H24F4N4O8S — CID 170582338
N-[[2-[6-(2,2-difluorocyclopropyl)-5-(1,1,2,2,2-pentahydroxyethoxy)-2-pyridinyl]-1,6-naphthyridin-7-yl]methyl]-4,9-difluoro-3,4-dihydro-2H-1,5-benzoxathiepine-7-carboxamide (PubChem CID 170582338) has the molecular formula C29H24F4N4O8S and a molecular weight of 664.59 g/mol. Its IUPAC name is N-[[2-[6-(2,2-difluorocyclopropyl)-5-(1,1,2,2,2-pentahydroxyethoxy)-2-pyridinyl]-1,6-naphthyridin-7-yl]methyl]-4,9-difluoro-3,4-dihydro-2H-1,5-benzoxathiepine-7-carboxamide.
| Compound Name | N-[[2-[6-(2,2-difluorocyclopropyl)-5-(1,1,2,2,2-pentahydroxyethoxy)-2-pyridinyl]-1,6-naphthyridin-7-yl]methyl]-4,9-difluoro-3,4-dihydro-2H-1,5-benzoxathiepine-7-carboxamide |
|---|---|
| PubChem CID | 170582338 |
| Molecular Formula | C29H24F4N4O8S |
| Molecular Weight | 664.59 g/mol |
| Exact Mass | 664.13 |
| IUPAC Name | N-[[2-[6-(2,2-difluorocyclopropyl)-5-(1,1,2,2,2-pentahydroxyethoxy)-2-pyridinyl]-1,6-naphthyridin-7-yl]methyl]-4,9-difluoro-3,4-dihydro-2H-1,5-benzoxathiepine-7-carboxamide |
| SMILES | O=C(NCc1cc2nc(-c3ccc(OC(O)(O)C(O)(O)O)c(C4CC4(F)F)n3)ccc2cn1)c1cc(F)c2c(c1)SC(F)CCO2 |
| InChI | InChI=1S/C29H24F4N4O8S/c30-17-7-14(8-22-25(17)44-6-5-23(31)46-22)26(38)35-12-15-9-20-13(11-34-15)1-2-18(36-20)19-3-4-21(45-29(42,43)28(39,40)41)24(37-19)16-10-27(16,32)33/h1-4,7-9,11,16,23,39-43H,5-6,10,12H2,(H,35,38) |
| InChIKey | XDHGTIATMNWQEK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 187.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.59 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|