C28H22ClF3N4O8S — CID 170582302
9-chloro-N-[[2-[6-cyclopropyl-5-(difluoromethoxy)-2-pyridinyl]-1,6-naphthyridin-7-yl]methyl]-4-fluoro-2,2,3,3-tetrahydroxy-5-oxo-4H-1,5λ4-benzoxathiepine-7-carboxamide (PubChem CID 170582302) has the molecular formula C28H22ClF3N4O8S and a molecular weight of 667.02 g/mol. Its IUPAC name is 9-chloro-N-[[2-[6-cyclopropyl-5-(difluoromethoxy)-2-pyridinyl]-1,6-naphthyridin-7-yl]methyl]-4-fluoro-2,2,3,3-tetrahydroxy-5-oxo-4H-1,5λ4-benzoxathiepine-7-carboxamide.
| Compound Name | 9-chloro-N-[[2-[6-cyclopropyl-5-(difluoromethoxy)-2-pyridinyl]-1,6-naphthyridin-7-yl]methyl]-4-fluoro-2,2,3,3-tetrahydroxy-5-oxo-4H-1,5λ4-benzoxathiepine-7-carboxamide |
|---|---|
| PubChem CID | 170582302 |
| Molecular Formula | C28H22ClF3N4O8S |
| Molecular Weight | 667.02 g/mol |
| Exact Mass | 666.08 |
| IUPAC Name | 9-chloro-N-[[2-[6-cyclopropyl-5-(difluoromethoxy)-2-pyridinyl]-1,6-naphthyridin-7-yl]methyl]-4-fluoro-2,2,3,3-tetrahydroxy-5-oxo-4H-1,5λ4-benzoxathiepine-7-carboxamide |
| SMILES | O=C(NCc1cc2nc(-c3ccc(OC(F)F)c(C4CC4)n3)ccc2cn1)c1cc(Cl)c2c(c1)S(=O)C(F)C(O)(O)C(O)(O)O2 |
| InChI | InChI=1S/C28H22ClF3N4O8S/c29-16-7-14(8-21-23(16)44-28(40,41)27(38,39)25(30)45(21)42)24(37)34-11-15-9-19-13(10-33-15)3-4-17(35-19)18-5-6-20(43-26(31)32)22(36-18)12-1-2-12/h3-10,12,25-26,38-41H,1-2,11H2,(H,34,37) |
| InChIKey | RBAVFPNYQAZWEA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 184.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.02 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|