C25H18ClF3N4O5S — CID 170521169
(4R)-9-chloro-2,2,3,3-tetradeuterio-N-[[2-[6-(difluoromethoxy)-2-pyridinyl]-1,6-naphthyridin-7-yl]methyl]-4-fluoro-5,5-dioxo-4H-1,5λ6-benzoxathiepine-7-carboxamide (PubChem CID 170521169) has the molecular formula C25H18ClF3N4O5S and a molecular weight of 582.98 g/mol. Its IUPAC name is (4R)-9-chloro-2,2,3,3-tetradeuterio-N-[[2-[6-(difluoromethoxy)-2-pyridinyl]-1,6-naphthyridin-7-yl]methyl]-4-fluoro-5,5-dioxo-4H-1,5λ6-benzoxathiepine-7-carboxamide.
| Compound Name | (4R)-9-chloro-2,2,3,3-tetradeuterio-N-[[2-[6-(difluoromethoxy)-2-pyridinyl]-1,6-naphthyridin-7-yl]methyl]-4-fluoro-5,5-dioxo-4H-1,5λ6-benzoxathiepine-7-carboxamide |
|---|---|
| PubChem CID | 170521169 |
| Molecular Formula | C25H18ClF3N4O5S |
| Molecular Weight | 582.98 g/mol |
| Exact Mass | 582.09 |
| IUPAC Name | (4R)-9-chloro-2,2,3,3-tetradeuterio-N-[[2-[6-(difluoromethoxy)-2-pyridinyl]-1,6-naphthyridin-7-yl]methyl]-4-fluoro-5,5-dioxo-4H-1,5λ6-benzoxathiepine-7-carboxamide |
| SMILES | [2H]C1([2H])Oc2c(Cl)cc(C(=O)NCc3cc4nc(-c5cccc(OC(F)F)n5)ccc4cn3)cc2S(=O)(=O)[C@@H](F)C1([2H])[2H] |
| InChI | InChI=1S/C25H18ClF3N4O5S/c26-16-8-14(9-20-23(16)37-7-6-21(27)39(20,35)36)24(34)31-12-15-10-19-13(11-30-15)4-5-18(32-19)17-2-1-3-22(33-17)38-25(28)29/h1-5,8-11,21,25H,6-7,12H2,(H,31,34)/t21-/m1/s1/i6D2,7D2 |
| InChIKey | AQNPCILBLHVMQP-PPSZGVSCSA-N |
| XLogP | 4.73 |
| TPSA | 120.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.98 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |