C30H24ClF4N5O4 — CID 170583552
1-[3-[8-chloro-7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-2,5-dimethoxypyrido[4,3-d]pyrimidin-4-yl]-3,9-diazabicyclo[3.3.1]nonan-7-yl]-2,2,2-trifluoroethanone (PubChem CID 170583552) has the molecular formula C30H24ClF4N5O4 and a molecular weight of 630.00 g/mol. Its IUPAC name is 1-[3-[8-chloro-7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-2,5-dimethoxypyrido[4,3-d]pyrimidin-4-yl]-3,9-diazabicyclo[3.3.1]nonan-7-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[3-[8-chloro-7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-2,5-dimethoxypyrido[4,3-d]pyrimidin-4-yl]-3,9-diazabicyclo[3.3.1]nonan-7-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 170583552 |
| Molecular Formula | C30H24ClF4N5O4 |
| Molecular Weight | 630.00 g/mol |
| Exact Mass | 629.15 |
| IUPAC Name | 1-[3-[8-chloro-7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-2,5-dimethoxypyrido[4,3-d]pyrimidin-4-yl]-3,9-diazabicyclo[3.3.1]nonan-7-yl]-2,2,2-trifluoroethanone |
| SMILES | C#Cc1c(F)ccc2cc(O)cc(-c3nc(OC)c4c(N5CC6CC(C(=O)C(F)(F)F)CC(C5)N6)nc(OC)nc4c3Cl)c12 |
| InChI | InChI=1S/C30H24ClF4N5O4/c1-4-18-20(32)6-5-13-9-17(41)10-19(21(13)18)24-23(31)25-22(28(37-24)43-2)27(39-29(38-25)44-3)40-11-15-7-14(8-16(12-40)36-15)26(42)30(33,34)35/h1,5-6,9-10,14-16,36,41H,7-8,11-12H2,2-3H3 |
| InChIKey | DWFUZZHSYJOWOU-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 109.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.00 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|