C33H34F3N5O4 — CID 170956336
1-[7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoro-2,5-dimethoxypyrido[4,3-d]pyrimidin-4-yl]piperidin-3-ol;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine (PubChem CID 170956336) has the molecular formula C33H34F3N5O4 and a molecular weight of 621.66 g/mol. Its IUPAC name is 1-[7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoro-2,5-dimethoxypyrido[4,3-d]pyrimidin-4-yl]piperidin-3-ol;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine.
| Compound Name | 1-[7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoro-2,5-dimethoxypyrido[4,3-d]pyrimidin-4-yl]piperidin-3-ol;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 170956336 |
| Molecular Formula | C33H34F3N5O4 |
| Molecular Weight | 621.66 g/mol |
| Exact Mass | 621.26 |
| IUPAC Name | 1-[7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-8-fluoro-2,5-dimethoxypyrido[4,3-d]pyrimidin-4-yl]piperidin-3-ol;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
| SMILES | C#Cc1c(F)ccc2cc(O)cc(-c3nc(OC)c4c(N5CCCC(O)C5)nc(OC)nc4c3F)c12.FC1CC2CCCN2C1 |
| InChI | InChI=1S/C26H22F2N4O4.C7H12FN/c1-4-16-18(27)8-7-13-10-15(34)11-17(19(13)16)22-21(28)23-20(25(29-22)35-2)24(31-26(30-23)36-3)32-9-5-6-14(33)12-32;8-6-4-7-2-1-3-9(7)5-6/h1,7-8,10-11,14,33-34H,5-6,9,12H2,2-3H3;6-7H,1-5H2 |
| InChIKey | MCCVBZWUYDOBHP-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.66 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|