C35H39F3N4O3 — CID 170957112
5-ethynyl-6-fluoro-4-[8-fluoro-4-[(4-hydroxy-4-methylpentyl)-methylamino]-2-methoxyquinazolin-7-yl]naphthalen-2-ol;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine (PubChem CID 170957112) has the molecular formula C35H39F3N4O3 and a molecular weight of 620.72 g/mol. Its IUPAC name is 5-ethynyl-6-fluoro-4-[8-fluoro-4-[(4-hydroxy-4-methylpentyl)-methylamino]-2-methoxyquinazolin-7-yl]naphthalen-2-ol;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine.
| Compound Name | 5-ethynyl-6-fluoro-4-[8-fluoro-4-[(4-hydroxy-4-methylpentyl)-methylamino]-2-methoxyquinazolin-7-yl]naphthalen-2-ol;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 170957112 |
| Molecular Formula | C35H39F3N4O3 |
| Molecular Weight | 620.72 g/mol |
| Exact Mass | 620.30 |
| IUPAC Name | 5-ethynyl-6-fluoro-4-[8-fluoro-4-[(4-hydroxy-4-methylpentyl)-methylamino]-2-methoxyquinazolin-7-yl]naphthalen-2-ol;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
| SMILES | C#Cc1c(F)ccc2cc(O)cc(-c3ccc4c(N(C)CCCC(C)(C)O)nc(OC)nc4c3F)c12.FC1CC2CCCN2C1 |
| InChI | InChI=1S/C28H27F2N3O3.C7H12FN/c1-6-18-22(29)11-8-16-14-17(34)15-21(23(16)18)19-9-10-20-25(24(19)30)31-27(36-5)32-26(20)33(4)13-7-12-28(2,3)35;8-6-4-7-2-1-3-9(7)5-6/h1,8-11,14-15,34-35H,7,12-13H2,2-5H3;6-7H,1-5H2 |
| InChIKey | VIAANRVEFBFPIW-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.72 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|