C34H36F2N4O4 — CID 171105813
7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-2-methoxy-8-methyl-4-(3-methylpiperidin-1-yl)pyrano[4,3-d]pyrimidin-5-one;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine (PubChem CID 171105813) has the molecular formula C34H36F2N4O4 and a molecular weight of 602.68 g/mol. Its IUPAC name is 7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-2-methoxy-8-methyl-4-(3-methylpiperidin-1-yl)pyrano[4,3-d]pyrimidin-5-one;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine.
| Compound Name | 7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-2-methoxy-8-methyl-4-(3-methylpiperidin-1-yl)pyrano[4,3-d]pyrimidin-5-one;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 171105813 |
| Molecular Formula | C34H36F2N4O4 |
| Molecular Weight | 602.68 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | 7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-2-methoxy-8-methyl-4-(3-methylpiperidin-1-yl)pyrano[4,3-d]pyrimidin-5-one;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
| SMILES | C#Cc1c(F)ccc2cc(O)cc(-c3oc(=O)c4c(N5CCCC(C)C5)nc(OC)nc4c3C)c12.FC1CC2CCCN2C1 |
| InChI | InChI=1S/C27H24FN3O4.C7H12FN/c1-5-18-20(28)9-8-16-11-17(32)12-19(21(16)18)24-15(3)23-22(26(33)35-24)25(30-27(29-23)34-4)31-10-6-7-14(2)13-31;8-6-4-7-2-1-3-9(7)5-6/h1,8-9,11-12,14,32H,6-7,10,13H2,2-4H3;6-7H,1-5H2 |
| InChIKey | SPHKHQWVRIOSGG-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.68 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|