C14H30N2O2 — CID 170583919
N,2-dimethylpropanamide;4-pentylmorpholine (PubChem CID 170583919) has the molecular formula C14H30N2O2 and a molecular weight of 258.41 g/mol. Its IUPAC name is N,2-dimethylpropanamide;4-pentylmorpholine.
| Compound Name | N,2-dimethylpropanamide;4-pentylmorpholine |
|---|---|
| PubChem CID | 170583919 |
| Molecular Formula | C14H30N2O2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | N,2-dimethylpropanamide;4-pentylmorpholine |
| SMILES | CCCCCN1CCOCC1.CNC(=O)C(C)C |
| InChI | InChI=1S/C9H19NO.C5H11NO/c1-2-3-4-5-10-6-8-11-9-7-10;1-4(2)5(7)6-3/h2-9H2,1H3;4H,1-3H3,(H,6,7) |
| InChIKey | CCCRTFAIZGKXKF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|